C20H9F10P — CID 90108633
(2,3-dimethylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 90108633) has the molecular formula C20H9F10P and a molecular weight of 470.25 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | (2,3-dimethylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 90108633 |
| Molecular Formula | C20H9F10P |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | (2,3-dimethylphenyl)-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | Cc1cccc(P(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c1C |
| InChI | InChI=1S/C20H9F10P/c1-6-4-3-5-8(7(6)2)31(19-15(27)11(23)9(21)12(24)16(19)28)20-17(29)13(25)10(22)14(26)18(20)30/h3-5H,1-2H3 |
| InChIKey | AEBJKYRSFOAEMR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|