About chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride
chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride (PubChem CID 175534500) has the molecular formula C15H21Cl3CrNP
and a molecular weight of 404.67 g/mol. Its IUPAC name is chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride.
Molecular Properties
| Compound Name | chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride |
| PubChem CID | 175534500 |
| Molecular Formula | C15H21Cl3CrNP |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride |
| SMILES | CC(C)NP(c1ccccc1)c1ccccc1.Cl.Cl.Cl.[Cr] |
| InChI | InChI=1S/C15H18NP.3ClH.Cr/c1-13(2)16-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15;;;;/h3-13,16H,1-2H3;3*1H; |
| InChIKey | OPQBMWRQBFKHMV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride?
The IUPAC name of chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride (CID 175534500) is chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride.
What is the SMILES notation for chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride?
The canonical SMILES for chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride is CC(C)NP(c1ccccc1)c1ccccc1.Cl.Cl.Cl.[Cr].
What is the InChIKey of chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride?
The InChIKey is OPQBMWRQBFKHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18NP.3ClH.Cr/c1-13(2)16-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15;;;;/h3-13,16H,1-2H3;3*1H;.
What are the key properties of chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride?
chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride has a molecular weight of 404.67 g/mol, XLogP of 4.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;N-diphenylphosphanylpropan-2-amine;trihydrochloride is sourced from PubChem (CID 175534500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).