C25H22N2P2S — CID 11189990
1,3-bis(diphenylphosphanyl)thiourea (PubChem CID 11189990) has the molecular formula C25H22N2P2S and a molecular weight of 444.48 g/mol. Its IUPAC name is 1,3-bis(diphenylphosphanyl)thiourea.
| Compound Name | 1,3-bis(diphenylphosphanyl)thiourea |
|---|---|
| PubChem CID | 11189990 |
| Molecular Formula | C25H22N2P2S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1,3-bis(diphenylphosphanyl)thiourea |
| SMILES | S=C(NP(c1ccccc1)c1ccccc1)NP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2P2S/c30-25(26-28(21-13-5-1-6-14-21)22-15-7-2-8-16-22)27-29(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H,(H2,26,27,30) |
| InChIKey | JALOGEXWAUOARS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|