About diphenylphosphinous acid;hydrochloride
diphenylphosphinous acid;hydrochloride (PubChem CID 67934097) has the molecular formula C12H12ClOP
and a molecular weight of 238.65 g/mol. Its IUPAC name is diphenylphosphinous acid;hydrochloride.
Molecular Properties
| Compound Name | diphenylphosphinous acid;hydrochloride |
| PubChem CID | 67934097 |
| Molecular Formula | C12H12ClOP |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | diphenylphosphinous acid;hydrochloride |
| SMILES | Cl.OP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11OP.ClH/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;1H |
| InChIKey | VKYRHHGCPMPOJA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphinous acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphinous acid;hydrochloride?
The IUPAC name of diphenylphosphinous acid;hydrochloride (CID 67934097) is diphenylphosphinous acid;hydrochloride.
What is the SMILES notation for diphenylphosphinous acid;hydrochloride?
The canonical SMILES for diphenylphosphinous acid;hydrochloride is Cl.OP(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphinous acid;hydrochloride?
The InChIKey is VKYRHHGCPMPOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11OP.ClH/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H;1H.
What are the key properties of diphenylphosphinous acid;hydrochloride?
diphenylphosphinous acid;hydrochloride has a molecular weight of 238.65 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphinous acid;hydrochloride is sourced from PubChem (CID 67934097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).