C17H16Cl2IrOP — CID 161215976
cyclopenta-1,3-diene;dichloroiridium(1+);diphenylphosphinous acid (PubChem CID 161215976) has the molecular formula C17H16Cl2IrOP and a molecular weight of 530.41 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichloroiridium(1+);diphenylphosphinous acid.
| Compound Name | cyclopenta-1,3-diene;dichloroiridium(1+);diphenylphosphinous acid |
|---|---|
| PubChem CID | 161215976 |
| Molecular Formula | C17H16Cl2IrOP |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | cyclopenta-1,3-diene;dichloroiridium(1+);diphenylphosphinous acid |
| SMILES | Cl[Ir+]Cl.OP(c1ccccc1)c1ccccc1.c1cc[cH-]c1 |
| InChI | InChI=1S/C12H11OP.C5H5.2ClH.Ir/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-4-5-3-1;;;/h1-10,13H;1-5H;2*1H;/q;-1;;;+3/p-2 |
| InChIKey | UWWGEZDZJOYQEE-UHFFFAOYSA-L |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|