About phenylphosphonous acid;zinc
phenylphosphonous acid;zinc (PubChem CID 141187307) has the molecular formula C6H7O2PZn
and a molecular weight of 207.48 g/mol. Its IUPAC name is phenylphosphonous acid;zinc.
Molecular Properties
| Compound Name | phenylphosphonous acid;zinc |
| PubChem CID | 141187307 |
| Molecular Formula | C6H7O2PZn |
| Molecular Weight | 207.48 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | phenylphosphonous acid;zinc |
| SMILES | OP(O)c1ccccc1.[Zn] |
| InChI | InChI=1S/C6H7O2P.Zn/c7-9(8)6-4-2-1-3-5-6;/h1-5,7-8H; |
| InChIKey | UESOBKPTSVPLNG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenylphosphonous acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylphosphonous acid;zinc?
The IUPAC name of phenylphosphonous acid;zinc (CID 141187307) is phenylphosphonous acid;zinc.
What is the SMILES notation for phenylphosphonous acid;zinc?
The canonical SMILES for phenylphosphonous acid;zinc is OP(O)c1ccccc1.[Zn].
What is the InChIKey of phenylphosphonous acid;zinc?
The InChIKey is UESOBKPTSVPLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O2P.Zn/c7-9(8)6-4-2-1-3-5-6;/h1-5,7-8H;.
What are the key properties of phenylphosphonous acid;zinc?
phenylphosphonous acid;zinc has a molecular weight of 207.48 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylphosphonous acid;zinc is sourced from PubChem (CID 141187307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).