C26H21P2S2- — CID 102010379
2,2-bis(diphenylphosphanyl)ethanedithioate (PubChem CID 102010379) has the molecular formula C26H21P2S2- and a molecular weight of 459.54 g/mol. Its IUPAC name is 2,2-bis(diphenylphosphanyl)ethanedithioate.
| Compound Name | 2,2-bis(diphenylphosphanyl)ethanedithioate |
|---|---|
| PubChem CID | 102010379 |
| Molecular Formula | C26H21P2S2- |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 2,2-bis(diphenylphosphanyl)ethanedithioate |
| SMILES | S=C([S-])C(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22P2S2/c29-26(30)25(27(21-13-5-1-6-14-21)22-15-7-2-8-16-22)28(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25H,(H,29,30)/p-1 |
| InChIKey | FXCRSNAWPDAKOT-UHFFFAOYSA-M |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|