C16H13F6OP — CID 87190189
1-diphenylphosphanyl-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol (PubChem CID 87190189) has the molecular formula C16H13F6OP and a molecular weight of 366.24 g/mol. Its IUPAC name is 1-diphenylphosphanyl-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol.
| Compound Name | 1-diphenylphosphanyl-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol |
|---|---|
| PubChem CID | 87190189 |
| Molecular Formula | C16H13F6OP |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 1-diphenylphosphanyl-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-ol |
| SMILES | OC(C(C(F)(F)F)C(F)(F)F)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H13F6OP/c17-15(18,19)13(16(20,21)22)14(23)24(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14,23H |
| InChIKey | DEIYDMRGDUTXKY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|