C14H15O3P — CID 174746690
2-diphenylphosphanylethane-1,1,2-triol (PubChem CID 174746690) has the molecular formula C14H15O3P and a molecular weight of 262.25 g/mol. Its IUPAC name is 2-diphenylphosphanylethane-1,1,2-triol.
| Compound Name | 2-diphenylphosphanylethane-1,1,2-triol |
|---|---|
| PubChem CID | 174746690 |
| Molecular Formula | C14H15O3P |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-diphenylphosphanylethane-1,1,2-triol |
| SMILES | OC(O)C(O)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15O3P/c15-13(16)14(17)18(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-17H |
| InChIKey | IEWNBMWNHSYWKI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|