C14H17N2P — CID 70150427
1-diphenylphosphanylethane-1,2-diamine (PubChem CID 70150427) has the molecular formula C14H17N2P and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-diphenylphosphanylethane-1,2-diamine.
| Compound Name | 1-diphenylphosphanylethane-1,2-diamine |
|---|---|
| PubChem CID | 70150427 |
| Molecular Formula | C14H17N2P |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-diphenylphosphanylethane-1,2-diamine |
| SMILES | NCC(N)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H17N2P/c15-11-14(16)17(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11,15-16H2 |
| InChIKey | FKHRRLMKFAQKGQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|