C14H13Cl2NiP — CID 88516422
1,2-dichloroethyl(diphenyl)phosphane;nickel (PubChem CID 88516422) has the molecular formula C14H13Cl2NiP and a molecular weight of 341.83 g/mol. Its IUPAC name is 1,2-dichloroethyl(diphenyl)phosphane;nickel.
| Compound Name | 1,2-dichloroethyl(diphenyl)phosphane;nickel |
|---|---|
| PubChem CID | 88516422 |
| Molecular Formula | C14H13Cl2NiP |
| Molecular Weight | 341.83 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 1,2-dichloroethyl(diphenyl)phosphane;nickel |
| SMILES | ClCC(Cl)P(c1ccccc1)c1ccccc1.[Ni] |
| InChI | InChI=1S/C14H13Cl2P.Ni/c15-11-14(16)17(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10,14H,11H2; |
| InChIKey | RZPVLPYBYMSVGM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|