C28H29ClO4P2 — CID 157197729
[(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane;perchloric acid (PubChem CID 157197729) has the molecular formula C28H29ClO4P2 and a molecular weight of 526.94 g/mol. Its IUPAC name is [(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane;perchloric acid.
| Compound Name | [(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane;perchloric acid |
|---|---|
| PubChem CID | 157197729 |
| Molecular Formula | C28H29ClO4P2 |
| Molecular Weight | 526.94 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [(2S,3S)-3-diphenylphosphanylbutan-2-yl]-diphenylphosphane;perchloric acid |
| SMILES | C[C@@H]([C@H](C)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C28H28P2.ClHO4/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28;2-1(3,4)5/h3-24H,1-2H3;(H,2,3,4,5)/t23-,24-;/m0./s1 |
| InChIKey | AQLCGTYBMJNLRY-UKOKCHKQSA-N |
| XLogP | 1.91 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.94 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|