C36H32N4P2 — CID 102285685
N,N'-bis(diphenylphosphanyl)-1,2-dipyridin-2-ylethane-1,2-diamine (PubChem CID 102285685) has the molecular formula C36H32N4P2 and a molecular weight of 582.63 g/mol. Its IUPAC name is N,N'-bis(diphenylphosphanyl)-1,2-dipyridin-2-ylethane-1,2-diamine.
| Compound Name | N,N'-bis(diphenylphosphanyl)-1,2-dipyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 102285685 |
| Molecular Formula | C36H32N4P2 |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | N,N'-bis(diphenylphosphanyl)-1,2-dipyridin-2-ylethane-1,2-diamine |
| SMILES | c1ccc(P(NC(c2ccccn2)C(NP(c2ccccc2)c2ccccc2)c2ccccn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H32N4P2/c1-5-17-29(18-6-1)41(30-19-7-2-8-20-30)39-35(33-25-13-15-27-37-33)36(34-26-14-16-28-38-34)40-42(31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28,35-36,39-40H |
| InChIKey | PKJVEVJMUOLONI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|