C26H36NOP — CID 162269645
[2-[1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-3-methylcyclopentyl]-diphenylphosphane (PubChem CID 162269645) has the molecular formula C26H36NOP and a molecular weight of 409.55 g/mol. Its IUPAC name is [2-[1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-3-methylcyclopentyl]-diphenylphosphane.
| Compound Name | [2-[1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-3-methylcyclopentyl]-diphenylphosphane |
|---|---|
| PubChem CID | 162269645 |
| Molecular Formula | C26H36NOP |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | [2-[1-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]ethyl]-3-methylcyclopentyl]-diphenylphosphane |
| SMILES | COC[C@@H]1CCCN1C(C)C1C(C)CCC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36NOP/c1-20-16-17-25(26(20)21(2)27-18-10-11-22(27)19-28-3)29(23-12-6-4-7-13-23)24-14-8-5-9-15-24/h4-9,12-15,20-22,25-26H,10-11,16-19H2,1-3H3/t20?,21?,22-,25?,26?/m0/s1 |
| InChIKey | IMQRJXCTOHJZLT-RDXMFEELSA-N |
| XLogP | 5.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|