C18H25NO — CID 11000172
(2S)-2-(methoxymethyl)-1-[(1E)-4-methyl-1-phenylpenta-1,3-dien-3-yl]pyrrolidine (PubChem CID 11000172) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (2S)-2-(methoxymethyl)-1-[(1E)-4-methyl-1-phenylpenta-1,3-dien-3-yl]pyrrolidine.
| Compound Name | (2S)-2-(methoxymethyl)-1-[(1E)-4-methyl-1-phenylpenta-1,3-dien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 11000172 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (2S)-2-(methoxymethyl)-1-[(1E)-4-methyl-1-phenylpenta-1,3-dien-3-yl]pyrrolidine |
| SMILES | COC[C@@H]1CCCN1C(/C=C/c1ccccc1)=C(C)C |
| InChI | InChI=1S/C18H25NO/c1-15(2)18(12-11-16-8-5-4-6-9-16)19-13-7-10-17(19)14-20-3/h4-6,8-9,11-12,17H,7,10,13-14H2,1-3H3/b12-11+/t17-/m0/s1 |
| InChIKey | WDHCFNCOHVBRCQ-FLVLSHQESA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|