C28H31N3O — CID 72976116
N-[[2-(methoxymethyl)pyrrolidin-1-yl]-phenylmethylidene]-N'-(1-phenylethyl)benzenecarboximidamide (PubChem CID 72976116) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[[2-(methoxymethyl)pyrrolidin-1-yl]-phenylmethylidene]-N'-(1-phenylethyl)benzenecarboximidamide.
| Compound Name | N-[[2-(methoxymethyl)pyrrolidin-1-yl]-phenylmethylidene]-N'-(1-phenylethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 72976116 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-[[2-(methoxymethyl)pyrrolidin-1-yl]-phenylmethylidene]-N'-(1-phenylethyl)benzenecarboximidamide |
| SMILES | COCC1CCCN1/C(=N\C(=N\C(C)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O/c1-22(23-13-6-3-7-14-23)29-27(24-15-8-4-9-16-24)30-28(25-17-10-5-11-18-25)31-20-12-19-26(31)21-32-2/h3-11,13-18,22,26H,12,19-21H2,1-2H3/b29-27+,30-28- |
| InChIKey | FISSDAQVUKDLBL-SWGBCSPSSA-N |
| XLogP | 5.75 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|