C25H34NOP — CID 58160428
[2-[(1S)-1-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]cyclopentyl]-diphenylphosphane (PubChem CID 58160428) has the molecular formula C25H34NOP and a molecular weight of 395.53 g/mol. Its IUPAC name is [2-[(1S)-1-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]cyclopentyl]-diphenylphosphane.
| Compound Name | [2-[(1S)-1-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]cyclopentyl]-diphenylphosphane |
|---|---|
| PubChem CID | 58160428 |
| Molecular Formula | C25H34NOP |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | [2-[(1S)-1-[2-(methoxymethyl)pyrrolidin-1-yl]ethyl]cyclopentyl]-diphenylphosphane |
| SMILES | COCC1CCCN1[C@@H](C)C1CCCC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34NOP/c1-20(26-18-10-11-21(26)19-27-2)24-16-9-17-25(24)28(22-12-5-3-6-13-22)23-14-7-4-8-15-23/h3-8,12-15,20-21,24-25H,9-11,16-19H2,1-2H3/t20-,21?,24?,25?/m0/s1 |
| InChIKey | QJAGAPJPXCMPJC-WBZHTJOCSA-N |
| XLogP | 4.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|