C17H20BNOP+ — CID 155935653
CID 155935653 (PubChem CID 155935653) has the molecular formula C17H20BNOP+ and a molecular weight of 296.14 g/mol.
| Compound Name | CID 155935653 |
|---|---|
| PubChem CID | 155935653 |
| Molecular Formula | C17H20BNOP+ |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | — |
| SMILES | [B][P+](c1ccccc1)(c1ccccc1)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C17H20BNOP/c18-21(16-9-3-1-4-10-16,17-11-5-2-6-12-17)19-13-7-8-15(19)14-20/h1-6,9-12,15,20H,7-8,13-14H2/q+1/t15-/m1/s1 |
| InChIKey | SAVXKOJHBVUVAM-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|