C13H17O5- — CID 138976154
[5-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopenta-1,3-dien-1-yl] acetate (PubChem CID 138976154) has the molecular formula C13H17O5- and a molecular weight of 253.27 g/mol. Its IUPAC name is [5-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopenta-1,3-dien-1-yl] acetate.
| Compound Name | [5-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopenta-1,3-dien-1-yl] acetate |
|---|---|
| PubChem CID | 138976154 |
| Molecular Formula | C13H17O5- |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [5-[(2S,4S)-4-(methoxymethyl)-1,3-dioxan-2-yl]cyclopenta-1,3-dien-1-yl] acetate |
| SMILES | COC[C@@H]1CCO[C@H]([c-]2cccc2OC(C)=O)O1 |
| InChI | InChI=1S/C13H17O5/c1-9(14)17-12-5-3-4-11(12)13-16-7-6-10(18-13)8-15-2/h3-5,10,13H,6-8H2,1-2H3/q-1/t10-,13-/m0/s1 |
| InChIKey | GDLROXBTLFWBMQ-GWCFXTLKSA-N |
| XLogP | 1.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|