C11H15O3- — CID 135037400
(4S)-2-cyclopenta-1,3-dien-1-yl-4-(methoxymethyl)-1,3-dioxane (PubChem CID 135037400) has the molecular formula C11H15O3- and a molecular weight of 195.24 g/mol. Its IUPAC name is (4S)-2-cyclopenta-1,3-dien-1-yl-4-(methoxymethyl)-1,3-dioxane.
| Compound Name | (4S)-2-cyclopenta-1,3-dien-1-yl-4-(methoxymethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 135037400 |
| Molecular Formula | C11H15O3- |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (4S)-2-cyclopenta-1,3-dien-1-yl-4-(methoxymethyl)-1,3-dioxane |
| SMILES | COC[C@@H]1CCOC(c2ccc[cH-]2)O1 |
| InChI | InChI=1S/C11H15O3/c1-12-8-10-6-7-13-11(14-10)9-4-2-3-5-9/h2-5,10-11H,6-8H2,1H3/q-1/t10-,11?/m0/s1 |
| InChIKey | ZMIJYWJVRUTITE-VUWPPUDQSA-N |
| XLogP | 1.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|