C32H42P2 — CID 138962255
dicyclohexyl-[(1R)-1-(2-diphenylphosphanyl-3-methylcyclopenta-2,4-dien-1-yl)ethyl]phosphane (PubChem CID 138962255) has the molecular formula C32H42P2 and a molecular weight of 488.64 g/mol. Its IUPAC name is dicyclohexyl-[(1R)-1-(2-diphenylphosphanyl-3-methylcyclopenta-2,4-dien-1-yl)ethyl]phosphane.
| Compound Name | dicyclohexyl-[(1R)-1-(2-diphenylphosphanyl-3-methylcyclopenta-2,4-dien-1-yl)ethyl]phosphane |
|---|---|
| PubChem CID | 138962255 |
| Molecular Formula | C32H42P2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | dicyclohexyl-[(1R)-1-(2-diphenylphosphanyl-3-methylcyclopenta-2,4-dien-1-yl)ethyl]phosphane |
| SMILES | CC1=C(P(c2ccccc2)c2ccccc2)C([C@@H](C)P(C2CCCCC2)C2CCCCC2)C=C1 |
| InChI | InChI=1S/C32H42P2/c1-25-23-24-31(26(2)33(27-15-7-3-8-16-27)28-17-9-4-10-18-28)32(25)34(29-19-11-5-12-20-29)30-21-13-6-14-22-30/h5-6,11-14,19-24,26-28,31H,3-4,7-10,15-18H2,1-2H3/t26-,31?/m1/s1 |
| InChIKey | OZEXNSIDHGRFKI-SYQKMTEESA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|