C26H31P — CID 174868751
ditert-butyl-(2,4-diphenylphenyl)phosphane (PubChem CID 174868751) has the molecular formula C26H31P and a molecular weight of 374.51 g/mol. Its IUPAC name is ditert-butyl-(2,4-diphenylphenyl)phosphane.
| Compound Name | ditert-butyl-(2,4-diphenylphenyl)phosphane |
|---|---|
| PubChem CID | 174868751 |
| Molecular Formula | C26H31P |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | ditert-butyl-(2,4-diphenylphenyl)phosphane |
| SMILES | CC(C)(C)P(c1ccc(-c2ccccc2)cc1-c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H31P/c1-25(2,3)27(26(4,5)6)24-18-17-22(20-13-9-7-10-14-20)19-23(24)21-15-11-8-12-16-21/h7-19H,1-6H3 |
| InChIKey | ZVOAHPKMXIBWLS-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|