C21H22Ge — CID 171435989
(2,4-diphenylphenyl)-trimethylgermane (PubChem CID 171435989) has the molecular formula C21H22Ge and a molecular weight of 347.02 g/mol. Its IUPAC name is (2,4-diphenylphenyl)-trimethylgermane.
| Compound Name | (2,4-diphenylphenyl)-trimethylgermane |
|---|---|
| PubChem CID | 171435989 |
| Molecular Formula | C21H22Ge |
| Molecular Weight | 347.02 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2,4-diphenylphenyl)-trimethylgermane |
| SMILES | C[Ge](C)(C)c1ccc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H22Ge/c1-22(2,3)21-15-14-19(17-10-6-4-7-11-17)16-20(21)18-12-8-5-9-13-18/h4-16H,1-3H3 |
| InChIKey | OSLVNIABNYGSIG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.02 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |