C33H42 — CID 175465233
2-(2-cyclohexylphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene (PubChem CID 175465233) has the molecular formula C33H42 and a molecular weight of 438.70 g/mol. Its IUPAC name is 2-(2-cyclohexylphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-(2-cyclohexylphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 175465233 |
| Molecular Formula | C33H42 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 2-(2-cyclohexylphenyl)-4-phenyl-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccccc2C2CCCCC2)c(C(C)C)c1-c1ccccc1 |
| InChI | InChI=1S/C33H42/c1-22(2)29-21-30(23(3)4)33(31(24(5)6)32(29)26-17-11-8-12-18-26)28-20-14-13-19-27(28)25-15-9-7-10-16-25/h8,11-14,17-25H,7,9-10,15-16H2,1-6H3 |
| InChIKey | AUWZGMMJVYFOOL-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |