C8H7IO2 — CID 102239319
2-iodo-7-methoxycyclohepta-2,4,6-trien-1-one (PubChem CID 102239319) has the molecular formula C8H7IO2 and a molecular weight of 262.05 g/mol. Its IUPAC name is 2-iodo-7-methoxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-iodo-7-methoxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 102239319 |
| Molecular Formula | C8H7IO2 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 2-iodo-7-methoxycyclohepta-2,4,6-trien-1-one |
| SMILES | COc1ccccc(I)c1=O |
| InChI | InChI=1S/C8H7IO2/c1-11-7-5-3-2-4-6(9)8(7)10/h2-5H,1H3 |
| InChIKey | GEYIUVQPVDRJFP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|