About methyl 2-iodo-6-methoxybenzoate
methyl 2-iodo-6-methoxybenzoate (PubChem CID 91882308) has the molecular formula C9H9IO3
and a molecular weight of 292.07 g/mol. Its IUPAC name is methyl 2-iodo-6-methoxybenzoate.
Molecular Properties
| Compound Name | methyl 2-iodo-6-methoxybenzoate |
| PubChem CID | 91882308 |
| Molecular Formula | C9H9IO3 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | methyl 2-iodo-6-methoxybenzoate |
| SMILES | COC(=O)c1c(I)cccc1OC |
| InChI | InChI=1S/C9H9IO3/c1-12-7-5-3-4-6(10)8(7)9(11)13-2/h3-5H,1-2H3 |
| InChIKey | UKQWVJWPFLNUPQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-iodo-6-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-iodo-6-methoxybenzoate?
The IUPAC name of methyl 2-iodo-6-methoxybenzoate (CID 91882308) is methyl 2-iodo-6-methoxybenzoate.
What is the SMILES notation for methyl 2-iodo-6-methoxybenzoate?
The canonical SMILES for methyl 2-iodo-6-methoxybenzoate is COC(=O)c1c(I)cccc1OC.
What is the InChIKey of methyl 2-iodo-6-methoxybenzoate?
The InChIKey is UKQWVJWPFLNUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO3/c1-12-7-5-3-4-6(10)8(7)9(11)13-2/h3-5H,1-2H3.
What are the key properties of methyl 2-iodo-6-methoxybenzoate?
methyl 2-iodo-6-methoxybenzoate has a molecular weight of 292.07 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-iodo-6-methoxybenzoate is sourced from PubChem (CID 91882308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).