About 5-ethylidene-7,8-dihydro-6H-quinoline
5-ethylidene-7,8-dihydro-6H-quinoline (PubChem CID 164582583) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 5-ethylidene-7,8-dihydro-6H-quinoline.
Molecular Properties
| Compound Name | 5-ethylidene-7,8-dihydro-6H-quinoline |
| PubChem CID | 164582583 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 5-ethylidene-7,8-dihydro-6H-quinoline |
| SMILES | CC=C1CCCc2ncccc21 |
| InChI | InChI=1S/C11H13N/c1-2-9-5-3-7-11-10(9)6-4-8-12-11/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | DNBYDFUNQSRKPP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethylidene-7,8-dihydro-6H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylidene-7,8-dihydro-6H-quinoline?
The IUPAC name of 5-ethylidene-7,8-dihydro-6H-quinoline (CID 164582583) is 5-ethylidene-7,8-dihydro-6H-quinoline.
What is the SMILES notation for 5-ethylidene-7,8-dihydro-6H-quinoline?
The canonical SMILES for 5-ethylidene-7,8-dihydro-6H-quinoline is CC=C1CCCc2ncccc21.
What is the InChIKey of 5-ethylidene-7,8-dihydro-6H-quinoline?
The InChIKey is DNBYDFUNQSRKPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-9-5-3-7-11-10(9)6-4-8-12-11/h2,4,6,8H,3,5,7H2,1H3.
What are the key properties of 5-ethylidene-7,8-dihydro-6H-quinoline?
5-ethylidene-7,8-dihydro-6H-quinoline has a molecular weight of 159.23 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylidene-7,8-dihydro-6H-quinoline is sourced from PubChem (CID 164582583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).