C19H28N4 — CID 177012631
ethane;(3Z,5Z)-3-ethenyl-5-hydrazinyl-2-methyl-4-[(Z)-prop-1-enyl]-1H-2-benzazocin-6-amine (PubChem CID 177012631) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is ethane;(3Z,5Z)-3-ethenyl-5-hydrazinyl-2-methyl-4-[(Z)-prop-1-enyl]-1H-2-benzazocin-6-amine.
| Compound Name | ethane;(3Z,5Z)-3-ethenyl-5-hydrazinyl-2-methyl-4-[(Z)-prop-1-enyl]-1H-2-benzazocin-6-amine |
|---|---|
| PubChem CID | 177012631 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | ethane;(3Z,5Z)-3-ethenyl-5-hydrazinyl-2-methyl-4-[(Z)-prop-1-enyl]-1H-2-benzazocin-6-amine |
| SMILES | C=C/C1=C(\C=C/C)C(/NN)=C(/N)c2ccccc2CN1C.CC |
| InChI | InChI=1S/C17H22N4.C2H6/c1-4-8-14-15(5-2)21(3)11-12-9-6-7-10-13(12)16(18)17(14)20-19;1-2/h4-10,20H,2,11,18-19H2,1,3H3;1-2H3/b8-4-,15-14-,17-16-; |
| InChIKey | DPVBTPIVVSVKIF-HXOJWIKUSA-N |
| XLogP | 3.27 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|