C16H15N4W- — CID 177166592
(7Z)-7,8-bis(ethenyl)-9-methyl-4,5,9-triaza-3-azanidatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;tungsten (PubChem CID 177166592) has the molecular formula C16H15N4W- and a molecular weight of 447.16 g/mol. Its IUPAC name is (7Z)-7,8-bis(ethenyl)-9-methyl-4,5,9-triaza-3-azanidatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;tungsten.
| Compound Name | (7Z)-7,8-bis(ethenyl)-9-methyl-4,5,9-triaza-3-azanidatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;tungsten |
|---|---|
| PubChem CID | 177166592 |
| Molecular Formula | C16H15N4W- |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | (7Z)-7,8-bis(ethenyl)-9-methyl-4,5,9-triaza-3-azanidatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;tungsten |
| SMILES | C=C/C1=C(\C=C)N(C)Cc2ccccc2-c2[n-]nnc21.[W] |
| InChI | InChI=1S/C16H15N4.W/c1-4-12-14(5-2)20(3)10-11-8-6-7-9-13(11)16-15(12)17-19-18-16;/h4-9H,1-2,10H2,3H3;/q-1;/b14-12-; |
| InChIKey | QABVAURQJJGLGK-CTMPBGLUSA-N |
| XLogP | 2.63 |
| TPSA | 43.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |