C23H33N3 — CID 170771398
(7Z)-7,8-bis(ethenyl)-3,9-dimethyl-3,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;ethane;propane (PubChem CID 170771398) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is (7Z)-7,8-bis(ethenyl)-3,9-dimethyl-3,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;ethane;propane.
| Compound Name | (7Z)-7,8-bis(ethenyl)-3,9-dimethyl-3,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;ethane;propane |
|---|---|
| PubChem CID | 170771398 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | (7Z)-7,8-bis(ethenyl)-3,9-dimethyl-3,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),4,7,11,13-hexaene;ethane;propane |
| SMILES | C=C/C1=C(\C=C)C(C)Cc2ccccc2-c2c1nnn2C.CC.CCC |
| InChI | InChI=1S/C18H19N3.C3H8.C2H6/c1-5-14-12(3)11-13-9-7-8-10-16(13)18-17(15(14)6-2)19-20-21(18)4;1-3-2;1-2/h5-10,12H,1-2,11H2,3-4H3;3H2,1-2H3;1-2H3/b15-14-;; |
| InChIKey | UPAVVZIHWHXPLI-GEKVWEGFSA-N |
| XLogP | 6.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |