C36H34N6 — CID 162080070
azidomethane;5,14-dimethyl-3,4,5-triazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaene;10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-2-yne (PubChem CID 162080070) has the molecular formula C36H34N6 and a molecular weight of 550.71 g/mol. Its IUPAC name is azidomethane;5,14-dimethyl-3,4,5-triazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaene;10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-2-yne.
| Compound Name | azidomethane;5,14-dimethyl-3,4,5-triazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaene;10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-2-yne |
|---|---|
| PubChem CID | 162080070 |
| Molecular Formula | C36H34N6 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | azidomethane;5,14-dimethyl-3,4,5-triazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaene;10-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-2-yne |
| SMILES | CC1Cc2ccccc2-c2c(nnn2C)-c2ccccc21.CC1Cc2ccccc2C#Cc2ccccc21.CN=[N+]=[N-] |
| InChI | InChI=1S/C18H17N3.C17H14.CH3N3/c1-12-11-13-7-3-4-9-15(13)18-17(19-20-21(18)2)16-10-6-5-8-14(12)16;1-13-12-16-8-3-2-6-14(16)10-11-15-7-4-5-9-17(13)15;1-3-4-2/h3-10,12H,11H2,1-2H3;2-9,13H,12H2,1H3;1H3 |
| InChIKey | ZCFKPYAICNDDIP-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|