C13H11ClN2 — CID 115419533
3-chloro-6-methyl-5,6-dihydrobenzo[h]cinnoline (PubChem CID 115419533) has the molecular formula C13H11ClN2 and a molecular weight of 230.70 g/mol. Its IUPAC name is 3-chloro-6-methyl-5,6-dihydrobenzo[h]cinnoline.
| Compound Name | 3-chloro-6-methyl-5,6-dihydrobenzo[h]cinnoline |
|---|---|
| PubChem CID | 115419533 |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 3-chloro-6-methyl-5,6-dihydrobenzo[h]cinnoline |
| SMILES | CC1Cc2cc(Cl)nnc2-c2ccccc21 |
| InChI | InChI=1S/C13H11ClN2/c1-8-6-9-7-12(14)15-16-13(9)11-5-3-2-4-10(8)11/h2-5,7-8H,6H2,1H3 |
| InChIKey | MPPROGGLZYUJRS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |