C18H16N2S — CID 115419375
2-(5-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)aniline (PubChem CID 115419375) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-(5-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)aniline.
| Compound Name | 2-(5-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 115419375 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(5-methyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)aniline |
| SMILES | CC1Cc2sc(-c3ccccc3N)nc2-c2ccccc21 |
| InChI | InChI=1S/C18H16N2S/c1-11-10-16-17(13-7-3-2-6-12(11)13)20-18(21-16)14-8-4-5-9-15(14)19/h2-9,11H,10,19H2,1H3 |
| InChIKey | HOTWNZDSJCZQGQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|