C13H10Cl2N2 — CID 115420771
2,4-dichloro-6-methyl-5,6-dihydrobenzo[h]quinazoline (PubChem CID 115420771) has the molecular formula C13H10Cl2N2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 2,4-dichloro-6-methyl-5,6-dihydrobenzo[h]quinazoline.
| Compound Name | 2,4-dichloro-6-methyl-5,6-dihydrobenzo[h]quinazoline |
|---|---|
| PubChem CID | 115420771 |
| Molecular Formula | C13H10Cl2N2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2,4-dichloro-6-methyl-5,6-dihydrobenzo[h]quinazoline |
| SMILES | CC1Cc2c(Cl)nc(Cl)nc2-c2ccccc21 |
| InChI | InChI=1S/C13H10Cl2N2/c1-7-6-10-11(16-13(15)17-12(10)14)9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3 |
| InChIKey | QWYRNLYGUVDPLD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |