C13H12ClNO — CID 115420984
3-(chloromethyl)-5-methyl-4,5-dihydrobenzo[g][1,2]benzoxazole (PubChem CID 115420984) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is 3-(chloromethyl)-5-methyl-4,5-dihydrobenzo[g][1,2]benzoxazole.
| Compound Name | 3-(chloromethyl)-5-methyl-4,5-dihydrobenzo[g][1,2]benzoxazole |
|---|---|
| PubChem CID | 115420984 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 3-(chloromethyl)-5-methyl-4,5-dihydrobenzo[g][1,2]benzoxazole |
| SMILES | CC1Cc2c(CCl)noc2-c2ccccc21 |
| InChI | InChI=1S/C13H12ClNO/c1-8-6-11-12(7-14)15-16-13(11)10-5-3-2-4-9(8)10/h2-5,8H,6-7H2,1H3 |
| InChIKey | WZRJRPYBRGJWCB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|