C12H10ClNO — CID 130570397
3-(chloromethyl)-4-methyl-4H-indeno[2,1-d][1,2]oxazole (PubChem CID 130570397) has the molecular formula C12H10ClNO and a molecular weight of 219.67 g/mol. Its IUPAC name is 3-(chloromethyl)-4-methyl-4H-indeno[2,1-d][1,2]oxazole.
| Compound Name | 3-(chloromethyl)-4-methyl-4H-indeno[2,1-d][1,2]oxazole |
|---|---|
| PubChem CID | 130570397 |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 3-(chloromethyl)-4-methyl-4H-indeno[2,1-d][1,2]oxazole |
| SMILES | CC1c2ccccc2-c2onc(CCl)c21 |
| InChI | InChI=1S/C12H10ClNO/c1-7-8-4-2-3-5-9(8)12-11(7)10(6-13)14-15-12/h2-5,7H,6H2,1H3 |
| InChIKey | ZHSNFARZEXAEJF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|