C13H17ClSi — CID 142448765
chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane (PubChem CID 142448765) has the molecular formula C13H17ClSi and a molecular weight of 236.82 g/mol. Its IUPAC name is chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane.
| Compound Name | chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 142448765 |
| Molecular Formula | C13H17ClSi |
| Molecular Weight | 236.82 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane |
| SMILES | CC1=C([Si](C)(C)Cl)C(C)c2ccccc21 |
| InChI | InChI=1S/C13H17ClSi/c1-9-11-7-5-6-8-12(11)10(2)13(9)15(3,4)14/h5-9H,1-4H3 |
| InChIKey | ANXICAANNVXBFH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|