About chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane
chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane (PubChem CID 142448765) has the molecular formula C13H17ClSi
and a molecular weight of 236.82 g/mol. Its IUPAC name is chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane.
Molecular Properties
| Compound Name | chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane |
| PubChem CID | 142448765 |
| Molecular Formula | C13H17ClSi |
| Molecular Weight | 236.82 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane |
| SMILES | CC1=C([Si](C)(C)Cl)C(C)c2ccccc21 |
| InChI | InChI=1S/C13H17ClSi/c1-9-11-7-5-6-8-12(11)10(2)13(9)15(3,4)14/h5-9H,1-4H3 |
| InChIKey | ANXICAANNVXBFH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane?
The IUPAC name of chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane (CID 142448765) is chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane.
What is the SMILES notation for chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane?
The canonical SMILES for chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane is CC1=C([Si](C)(C)Cl)C(C)c2ccccc21.
What is the InChIKey of chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane?
The InChIKey is ANXICAANNVXBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClSi/c1-9-11-7-5-6-8-12(11)10(2)13(9)15(3,4)14/h5-9H,1-4H3.
What are the key properties of chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane?
chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane has a molecular weight of 236.82 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(1,3-dimethyl-1H-inden-2-yl)-dimethylsilane is sourced from PubChem (CID 142448765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).