C18H15O2- — CID 162418391
(2E)-3,11-dimethyl-10-oxotricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaen-2-olate (PubChem CID 162418391) has the molecular formula C18H15O2- and a molecular weight of 263.32 g/mol. Its IUPAC name is (2E)-3,11-dimethyl-10-oxotricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaen-2-olate.
| Compound Name | (2E)-3,11-dimethyl-10-oxotricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaen-2-olate |
|---|---|
| PubChem CID | 162418391 |
| Molecular Formula | C18H15O2- |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (2E)-3,11-dimethyl-10-oxotricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaen-2-olate |
| SMILES | C/C1=C(\[O-])c2ccccc2C(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H16O2/c1-11-13-7-3-5-9-15(13)18(20)12(2)14-8-4-6-10-16(14)17(11)19/h3-11,20H,1-2H3/p-1/b18-12+ |
| InChIKey | CKCQLKUNGLPJKG-LDADJPATSA-M |
| XLogP | 3.23 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|