C14H12O4 — CID 163845357
9-methyl-9H-fluorene-1,2,3,4-tetrol (PubChem CID 163845357) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 9-methyl-9H-fluorene-1,2,3,4-tetrol.
| Compound Name | 9-methyl-9H-fluorene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 163845357 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 9-methyl-9H-fluorene-1,2,3,4-tetrol |
| SMILES | CC1c2ccccc2-c2c(O)c(O)c(O)c(O)c21 |
| InChI | InChI=1S/C14H12O4/c1-6-7-4-2-3-5-8(7)10-9(6)11(15)13(17)14(18)12(10)16/h2-6,15-18H,1H3 |
| InChIKey | OPQYLMXSCGWLPK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|