C16H17O+ — CID 134909481
2,3,4,9-tetramethyl-9H-indeno[2,1-b]pyran-1-ium (PubChem CID 134909481) has the molecular formula C16H17O+ and a molecular weight of 225.31 g/mol. Its IUPAC name is 2,3,4,9-tetramethyl-9H-indeno[2,1-b]pyran-1-ium.
| Compound Name | 2,3,4,9-tetramethyl-9H-indeno[2,1-b]pyran-1-ium |
|---|---|
| PubChem CID | 134909481 |
| Molecular Formula | C16H17O+ |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2,3,4,9-tetramethyl-9H-indeno[2,1-b]pyran-1-ium |
| SMILES | Cc1[o+]c2c(c(C)c1C)-c1ccccc1C2C |
| InChI | InChI=1S/C16H17O/c1-9-10(2)15-14-8-6-5-7-13(14)11(3)16(15)17-12(9)4/h5-8,11H,1-4H3/q+1 |
| InChIKey | SYPLZFCKDFFZFF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|