C12H11NO2 — CID 16641470
4,5-dihydrobenzo[g][1,2]benzoxazol-3-ylmethanol (PubChem CID 16641470) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 4,5-dihydrobenzo[g][1,2]benzoxazol-3-ylmethanol.
| Compound Name | 4,5-dihydrobenzo[g][1,2]benzoxazol-3-ylmethanol |
|---|---|
| PubChem CID | 16641470 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 4,5-dihydrobenzo[g][1,2]benzoxazol-3-ylmethanol |
| SMILES | OCc1noc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C12H11NO2/c14-7-11-10-6-5-8-3-1-2-4-9(8)12(10)15-13-11/h1-4,14H,5-7H2 |
| InChIKey | TVXPCUIEXRKWRI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |