C17H16BN3 — CID 174019778
3,13-dimethyl-3,4,5-triaza-13-boratetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene (PubChem CID 174019778) has the molecular formula C17H16BN3 and a molecular weight of 273.15 g/mol. Its IUPAC name is 3,13-dimethyl-3,4,5-triaza-13-boratetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene.
| Compound Name | 3,13-dimethyl-3,4,5-triaza-13-boratetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene |
|---|---|
| PubChem CID | 174019778 |
| Molecular Formula | C17H16BN3 |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3,13-dimethyl-3,4,5-triaza-13-boratetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaene |
| SMILES | CB1Cc2ccccc2-c2c(nnn2C)-c2ccccc21 |
| InChI | InChI=1S/C17H16BN3/c1-18-11-12-7-3-4-8-13(12)17-16(19-20-21(17)2)14-9-5-6-10-15(14)18/h3-10H,11H2,1-2H3 |
| InChIKey | UNDOUKKMPDLXKM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|