C15H10IN3 — CID 174332589
5-iodo-3,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaene (PubChem CID 174332589) has the molecular formula C15H10IN3 and a molecular weight of 359.17 g/mol. Its IUPAC name is 5-iodo-3,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaene.
| Compound Name | 5-iodo-3,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 174332589 |
| Molecular Formula | C15H10IN3 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 5-iodo-3,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaene |
| SMILES | In1nnc2c1-c1ccccc1Cc1ccccc1-2 |
| InChI | InChI=1S/C15H10IN3/c16-19-15-13-8-4-2-6-11(13)9-10-5-1-3-7-12(10)14(15)17-18-19/h1-8H,9H2 |
| InChIKey | LCZMSIQGYLLBNM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|