C10H7N3 — CID 140752161
5H-indeno[1,2-d]triazine (PubChem CID 140752161) has the molecular formula C10H7N3 and a molecular weight of 169.19 g/mol. Its IUPAC name is 5H-indeno[1,2-d]triazine.
| Compound Name | 5H-indeno[1,2-d]triazine |
|---|---|
| PubChem CID | 140752161 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 5H-indeno[1,2-d]triazine |
| SMILES | c1ccc2c(c1)Cc1cnnnc1-2 |
| InChI | InChI=1S/C10H7N3/c1-2-4-9-7(3-1)5-8-6-11-13-12-10(8)9/h1-4,6H,5H2 |
| InChIKey | AOXJQFFWUKOPAY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |