C14H14N4 — CID 123732458
(7Z)-7-ethylidene-5-methyl-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),3,8,11,13-hexaene (PubChem CID 123732458) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is (7Z)-7-ethylidene-5-methyl-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),3,8,11,13-hexaene.
| Compound Name | (7Z)-7-ethylidene-5-methyl-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),3,8,11,13-hexaene |
|---|---|
| PubChem CID | 123732458 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (7Z)-7-ethylidene-5-methyl-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),3,8,11,13-hexaene |
| SMILES | C/C=C1\C=N/Cc2ccccc2-c2nnn(C)c21 |
| InChI | InChI=1S/C14H14N4/c1-3-10-8-15-9-11-6-4-5-7-12(11)13-14(10)18(2)17-16-13/h3-8H,9H2,1-2H3/b10-3+,15-8- |
| InChIKey | CPTRTMUGMHGCAC-CPNQBIQPSA-N |
| XLogP | 2.47 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |