C20H26N4 — CID 156808003
(7Z)-8-ethenyl-9-methyl-3-propan-2-yl-7-[(Z)-prop-1-enyl]-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),7,11,13-pentaene (PubChem CID 156808003) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is (7Z)-8-ethenyl-9-methyl-3-propan-2-yl-7-[(Z)-prop-1-enyl]-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),7,11,13-pentaene.
| Compound Name | (7Z)-8-ethenyl-9-methyl-3-propan-2-yl-7-[(Z)-prop-1-enyl]-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),7,11,13-pentaene |
|---|---|
| PubChem CID | 156808003 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (7Z)-8-ethenyl-9-methyl-3-propan-2-yl-7-[(Z)-prop-1-enyl]-3,4,5,9-tetrazatricyclo[9.4.0.02,6]pentadeca-1(15),2(6),7,11,13-pentaene |
| SMILES | C=C/C1=C(\C=C/C)C2=C(c3ccccc3CN1C)N(C(C)C)NN2 |
| InChI | InChI=1S/C20H26N4/c1-6-10-17-18(7-2)23(5)13-15-11-8-9-12-16(15)20-19(17)21-22-24(20)14(3)4/h6-12,14,21-22H,2,13H2,1,3-5H3/b10-6-,18-17- |
| InChIKey | DNCVBWMQPWZWAQ-GCOHSWLKSA-N |
| XLogP | 3.55 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |