C19H23N3O2 — CID 142291730
[(5Z,7E)-5-amino-6-[amino(methyl)amino]-7,8-bis(ethenyl)-9,10-dihydrobenzo[8]annulen-10-yl] acetate (PubChem CID 142291730) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is [(5Z,7E)-5-amino-6-[amino(methyl)amino]-7,8-bis(ethenyl)-9,10-dihydrobenzo[8]annulen-10-yl] acetate.
| Compound Name | [(5Z,7E)-5-amino-6-[amino(methyl)amino]-7,8-bis(ethenyl)-9,10-dihydrobenzo[8]annulen-10-yl] acetate |
|---|---|
| PubChem CID | 142291730 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [(5Z,7E)-5-amino-6-[amino(methyl)amino]-7,8-bis(ethenyl)-9,10-dihydrobenzo[8]annulen-10-yl] acetate |
| SMILES | C=C/C1=C(C=C)/C(N(C)N)=C(/N)c2ccccc2C(OC(C)=O)C1 |
| InChI | InChI=1S/C19H23N3O2/c1-5-13-11-17(24-12(3)23)15-9-7-8-10-16(15)18(20)19(22(4)21)14(13)6-2/h5-10,17H,1-2,11,20-21H2,3-4H3/b14-13-,19-18- |
| InChIKey | ZZYADVZTKAHKTD-WUNLZOIISA-N |
| XLogP | 2.80 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|