C13H13IO3 — CID 137452937
(3-oxo-1,2-dihydroinden-1-yl) 2-iodobutanoate (PubChem CID 137452937) has the molecular formula C13H13IO3 and a molecular weight of 344.15 g/mol. Its IUPAC name is (3-oxo-1,2-dihydroinden-1-yl) 2-iodobutanoate.
| Compound Name | (3-oxo-1,2-dihydroinden-1-yl) 2-iodobutanoate |
|---|---|
| PubChem CID | 137452937 |
| Molecular Formula | C13H13IO3 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | (3-oxo-1,2-dihydroinden-1-yl) 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC1CC(=O)c2ccccc21 |
| InChI | InChI=1S/C13H13IO3/c1-2-10(14)13(16)17-12-7-11(15)8-5-3-4-6-9(8)12/h3-6,10,12H,2,7H2,1H3 |
| InChIKey | LPIMMYSSWKRFAT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|