C12H11BrO3 — CID 100986278
(3-oxo-1,2-dihydroinden-2-yl) 2-bromopropanoate (PubChem CID 100986278) has the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. Its IUPAC name is (3-oxo-1,2-dihydroinden-2-yl) 2-bromopropanoate.
| Compound Name | (3-oxo-1,2-dihydroinden-2-yl) 2-bromopropanoate |
|---|---|
| PubChem CID | 100986278 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | (3-oxo-1,2-dihydroinden-2-yl) 2-bromopropanoate |
| SMILES | CC(Br)C(=O)OC1Cc2ccccc2C1=O |
| InChI | InChI=1S/C12H11BrO3/c1-7(13)12(15)16-10-6-8-4-2-3-5-9(8)11(10)14/h2-5,7,10H,6H2,1H3 |
| InChIKey | YWTYGWZZQOHCBC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|