C16H18O6 — CID 7189073
diethyl 2-hydroxy-2-[(2S)-3-oxo-1,2-dihydroinden-2-yl]propanedioate (PubChem CID 7189073) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is diethyl 2-hydroxy-2-[(2S)-3-oxo-1,2-dihydroinden-2-yl]propanedioate.
| Compound Name | diethyl 2-hydroxy-2-[(2S)-3-oxo-1,2-dihydroinden-2-yl]propanedioate |
|---|---|
| PubChem CID | 7189073 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | diethyl 2-hydroxy-2-[(2S)-3-oxo-1,2-dihydroinden-2-yl]propanedioate |
| SMILES | CCOC(=O)C(O)(C(=O)OCC)[C@@H]1Cc2ccccc2C1=O |
| InChI | InChI=1S/C16H18O6/c1-3-21-14(18)16(20,15(19)22-4-2)12-9-10-7-5-6-8-11(10)13(12)17/h5-8,12,20H,3-4,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | OTQQSTUGEMBGOU-GFCCVEGCSA-N |
| XLogP | 0.90 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|